C22H21ClN6S — CID 46836261
6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(5-chlorothiophen-2-yl)-3-pyridin-4-ylimidazo[1,2-b]pyridazine (PubChem CID 46836261) has the molecular formula C22H21ClN6S and a molecular weight of 436.97 g/mol. Its IUPAC name is 6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(5-chlorothiophen-2-yl)-3-pyridin-4-ylimidazo[1,2-b]pyridazine.
| Compound Name | 6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(5-chlorothiophen-2-yl)-3-pyridin-4-ylimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 46836261 |
| Molecular Formula | C22H21ClN6S |
| Molecular Weight | 436.97 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(5-chlorothiophen-2-yl)-3-pyridin-4-ylimidazo[1,2-b]pyridazine |
| SMILES | CN1C[C@@H]2CN(c3ccc4nc(-c5ccc(Cl)s5)c(-c5ccncc5)n4n3)C[C@@H]2C1 |
| InChI | InChI=1S/C22H21ClN6S/c1-27-10-15-12-28(13-16(15)11-27)20-5-4-19-25-21(17-2-3-18(23)30-17)22(29(19)26-20)14-6-8-24-9-7-14/h2-9,15-16H,10-13H2,1H3/t15-,16+ |
| InChIKey | IVOAJQKTKKXICX-IYBDPMFKSA-N |
| XLogP | 4.17 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.97 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |