C42H51N3O8 — CID 46836488
[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(3,3,3-triphenylpropoxymethyl)oxolan-3-yl] 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 46836488) has the molecular formula C42H51N3O8 and a molecular weight of 725.88 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(3,3,3-triphenylpropoxymethyl)oxolan-3-yl] 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(3,3,3-triphenylpropoxymethyl)oxolan-3-yl] 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 46836488 |
| Molecular Formula | C42H51N3O8 |
| Molecular Weight | 725.88 g/mol |
| Exact Mass | 725.37 |
| IUPAC Name | [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(3,3,3-triphenylpropoxymethyl)oxolan-3-yl] 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CCC(C)C(NC(=O)OC(C)(C)C)C(=O)O[C@H]1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1COCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H51N3O8/c1-7-28(2)36(43-40(49)53-41(4,5)6)38(47)52-33-25-35(45-26-29(3)37(46)44-39(45)48)51-34(33)27-50-24-23-42(30-17-11-8-12-18-30,31-19-13-9-14-20-31)32-21-15-10-16-22-32/h8-22,26,28,33-36H,7,23-25,27H2,1-6H3,(H,43,49)(H,44,46,48)/t28?,33-,34+,35+,36?/m0/s1 |
| InChIKey | PAGHMQHEJRTNAP-URPHSTFWSA-N |
| XLogP | 6.43 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.88 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|