C22H26N6O2 — CID 46836770
[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-(3,6,8,9-tetrahydropyrazolo[4,3-f][2,7]naphthyridin-7-yl)methanone (PubChem CID 46836770) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is [4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-(3,6,8,9-tetrahydropyrazolo[4,3-f][2,7]naphthyridin-7-yl)methanone.
| Compound Name | [4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-(3,6,8,9-tetrahydropyrazolo[4,3-f][2,7]naphthyridin-7-yl)methanone |
|---|---|
| PubChem CID | 46836770 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | [4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-(3,6,8,9-tetrahydropyrazolo[4,3-f][2,7]naphthyridin-7-yl)methanone |
| SMILES | COc1ccc(CN2CCN(C(=O)N3CCc4c(cnc5[nH]ncc45)C3)CC2)cc1 |
| InChI | InChI=1S/C22H26N6O2/c1-30-18-4-2-16(3-5-18)14-26-8-10-27(11-9-26)22(29)28-7-6-19-17(15-28)12-23-21-20(19)13-24-25-21/h2-5,12-13H,6-11,14-15H2,1H3,(H,23,24,25) |
| InChIKey | LSNJKPQECVJBIB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |