C21H20N6S — CID 46836952
6-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-pyridin-4-yl-2-thiophen-3-ylimidazo[1,2-b]pyridazine (PubChem CID 46836952) has the molecular formula C21H20N6S and a molecular weight of 388.50 g/mol. Its IUPAC name is 6-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-pyridin-4-yl-2-thiophen-3-ylimidazo[1,2-b]pyridazine.
| Compound Name | 6-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-pyridin-4-yl-2-thiophen-3-ylimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 46836952 |
| Molecular Formula | C21H20N6S |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 6-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-pyridin-4-yl-2-thiophen-3-ylimidazo[1,2-b]pyridazine |
| SMILES | c1cc(-c2c(-c3ccsc3)nc3ccc(N4C[C@H]5CNC[C@H]5C4)nn23)ccn1 |
| InChI | InChI=1S/C21H20N6S/c1-2-19(26-11-16-9-23-10-17(16)12-26)25-27-18(1)24-20(15-5-8-28-13-15)21(27)14-3-6-22-7-4-14/h1-8,13,16-17,23H,9-12H2/t16-,17+ |
| InChIKey | CRJNSNHXWGTIPE-CALCHBBNSA-N |
| XLogP | 3.18 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |