C31H29FN6O2 — CID 46837048
1-(2-fluorophenyl)-3-[19-methyl-3-(2-methylpropyl)-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-7-yl]urea (PubChem CID 46837048) has the molecular formula C31H29FN6O2 and a molecular weight of 536.61 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[19-methyl-3-(2-methylpropyl)-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-7-yl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[19-methyl-3-(2-methylpropyl)-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-7-yl]urea |
|---|---|
| PubChem CID | 46837048 |
| Molecular Formula | C31H29FN6O2 |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[19-methyl-3-(2-methylpropyl)-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-7-yl]urea |
| SMILES | CC(C)Cn1c2ccc(NC(=O)Nc3ccccc3F)cc2c2c3c(c4c(c21)CCc1nn(C)cc1-4)C(=O)NC3 |
| InChI | InChI=1S/C31H29FN6O2/c1-16(2)14-38-25-11-8-17(34-31(40)35-24-7-5-4-6-22(24)32)12-19(25)27-20-13-33-30(39)28(20)26-18(29(27)38)9-10-23-21(26)15-37(3)36-23/h4-8,11-12,15-16H,9-10,13-14H2,1-3H3,(H,33,39)(H2,34,35,40) |
| InChIKey | RIJJCXACYTWGRV-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|