C28H22N4O4 — CID 4683709
2-cyano-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-N-(2-methoxyphenyl)prop-2-enamide (PubChem CID 4683709) has the molecular formula C28H22N4O4 and a molecular weight of 478.51 g/mol. Its IUPAC name is 2-cyano-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-N-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-N-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4683709 |
| Molecular Formula | C28H22N4O4 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 2-cyano-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-N-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1NC(=O)C(C#N)=Cc1cn(-c2ccccc2)nc1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C28H22N4O4/c1-34-24-10-6-5-9-23(24)30-28(33)20(17-29)15-21-18-32(22-7-3-2-4-8-22)31-27(21)19-11-12-25-26(16-19)36-14-13-35-25/h2-12,15-16,18H,13-14H2,1H3,(H,30,33) |
| InChIKey | CIEYRAGSFLLGFB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|