C22H34O2 — CID 46837206
1-[(1S,2R,5S,11S,12S,15S,16S)-5-hydroxy-2,16-dimethyl-15-tetracyclo[9.7.0.02,8.012,16]octadec-8-enyl]ethanone (PubChem CID 46837206) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is 1-[(1S,2R,5S,11S,12S,15S,16S)-5-hydroxy-2,16-dimethyl-15-tetracyclo[9.7.0.02,8.012,16]octadec-8-enyl]ethanone.
| Compound Name | 1-[(1S,2R,5S,11S,12S,15S,16S)-5-hydroxy-2,16-dimethyl-15-tetracyclo[9.7.0.02,8.012,16]octadec-8-enyl]ethanone |
|---|---|
| PubChem CID | 46837206 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | 1-[(1S,2R,5S,11S,12S,15S,16S)-5-hydroxy-2,16-dimethyl-15-tetracyclo[9.7.0.02,8.012,16]octadec-8-enyl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC=C4CC[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H34O2/c1-14(23)18-8-9-19-17-7-5-15-4-6-16(24)10-12-21(15,2)20(17)11-13-22(18,19)3/h5,16-20,24H,4,6-13H2,1-3H3/t16-,17-,18+,19-,20-,21-,22+/m0/s1 |
| InChIKey | ZXKKAGKIVMJTOF-BIBIXIOVSA-N |
| XLogP | 4.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|