C20H32N2 — CID 46837258
N-[2-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]ethyl]-2,4,6-trimethylaniline (PubChem CID 46837258) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is N-[2-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]ethyl]-2,4,6-trimethylaniline.
| Compound Name | N-[2-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]ethyl]-2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 46837258 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | N-[2-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]ethyl]-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(NCC[C@@H]2CCCN3CCCC[C@H]23)c(C)c1 |
| InChI | InChI=1S/C20H32N2/c1-15-13-16(2)20(17(3)14-15)21-10-9-18-7-6-12-22-11-5-4-8-19(18)22/h13-14,18-19,21H,4-12H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | CUVWKWHSKBVGCG-RBUKOAKNSA-N |
| XLogP | 4.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |