C20H32N2S — CID 46837259
N-[2-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylsulfanyl]ethyl]-2,6-dimethylaniline (PubChem CID 46837259) has the molecular formula C20H32N2S and a molecular weight of 332.56 g/mol. Its IUPAC name is N-[2-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylsulfanyl]ethyl]-2,6-dimethylaniline.
| Compound Name | N-[2-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylsulfanyl]ethyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 46837259 |
| Molecular Formula | C20H32N2S |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | N-[2-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylsulfanyl]ethyl]-2,6-dimethylaniline |
| SMILES | Cc1cccc(C)c1NCCSC[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C20H32N2S/c1-16-7-5-8-17(2)20(16)21-11-14-23-15-18-9-6-13-22-12-4-3-10-19(18)22/h5,7-8,18-19,21H,3-4,6,9-15H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | MHMHULAVHISMGI-RBUKOAKNSA-N |
| XLogP | 4.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|