C13H16O5 — CID 46837311
(5S)-5-[(1S,2R,3R)-1,2,3-trihydroxy-3-phenylpropyl]oxolan-2-one (PubChem CID 46837311) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is (5S)-5-[(1S,2R,3R)-1,2,3-trihydroxy-3-phenylpropyl]oxolan-2-one.
| Compound Name | (5S)-5-[(1S,2R,3R)-1,2,3-trihydroxy-3-phenylpropyl]oxolan-2-one |
|---|---|
| PubChem CID | 46837311 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (5S)-5-[(1S,2R,3R)-1,2,3-trihydroxy-3-phenylpropyl]oxolan-2-one |
| SMILES | O=C1CC[C@@H]([C@@H](O)[C@H](O)[C@H](O)c2ccccc2)O1 |
| InChI | InChI=1S/C13H16O5/c14-10-7-6-9(18-10)12(16)13(17)11(15)8-4-2-1-3-5-8/h1-5,9,11-13,15-17H,6-7H2/t9-,11+,12+,13+/m0/s1 |
| InChIKey | NFDZRAHFKPMWRE-WKSBVSIWSA-N |
| XLogP | 0.15 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |