C20H18O6 — CID 46837312
[(R)-[(2S,3S,3aR,6aR)-3-hydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl]-phenylmethyl] benzoate (PubChem CID 46837312) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is [(R)-[(2S,3S,3aR,6aR)-3-hydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl]-phenylmethyl] benzoate.
| Compound Name | [(R)-[(2S,3S,3aR,6aR)-3-hydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl]-phenylmethyl] benzoate |
|---|---|
| PubChem CID | 46837312 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [(R)-[(2S,3S,3aR,6aR)-3-hydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl]-phenylmethyl] benzoate |
| SMILES | O=C1C[C@H]2O[C@H]([C@H](OC(=O)c3ccccc3)c3ccccc3)[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C20H18O6/c21-15-11-14-18(25-15)16(22)19(24-14)17(12-7-3-1-4-8-12)26-20(23)13-9-5-2-6-10-13/h1-10,14,16-19,22H,11H2/t14-,16-,17-,18+,19+/m1/s1 |
| InChIKey | QAJCHVCZGQLPSV-DBDQLMEASA-N |
| XLogP | 2.03 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |