C31H24N4S — CID 46837322
4-amino-7-benzyl-3,5,6-triphenylpyrrolo[2,3-d]pyrimidine-2-thione (PubChem CID 46837322) has the molecular formula C31H24N4S and a molecular weight of 484.63 g/mol. Its IUPAC name is 4-amino-7-benzyl-3,5,6-triphenylpyrrolo[2,3-d]pyrimidine-2-thione.
| Compound Name | 4-amino-7-benzyl-3,5,6-triphenylpyrrolo[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 46837322 |
| Molecular Formula | C31H24N4S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 4-amino-7-benzyl-3,5,6-triphenylpyrrolo[2,3-d]pyrimidine-2-thione |
| SMILES | Nc1c2c(-c3ccccc3)c(-c3ccccc3)n(Cc3ccccc3)c2nc(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C31H24N4S/c32-29-27-26(23-15-7-2-8-16-23)28(24-17-9-3-10-18-24)34(21-22-13-5-1-6-14-22)30(27)33-31(36)35(29)25-19-11-4-12-20-25/h1-20H,21,32H2 |
| InChIKey | VNSHYGQKHSTSAC-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|