C24H16Cl2N4S — CID 46837323
4-amino-7-(3,4-dichlorophenyl)-3,5-diphenylpyrrolo[2,3-d]pyrimidine-2-thione (PubChem CID 46837323) has the molecular formula C24H16Cl2N4S and a molecular weight of 463.39 g/mol. Its IUPAC name is 4-amino-7-(3,4-dichlorophenyl)-3,5-diphenylpyrrolo[2,3-d]pyrimidine-2-thione.
| Compound Name | 4-amino-7-(3,4-dichlorophenyl)-3,5-diphenylpyrrolo[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 46837323 |
| Molecular Formula | C24H16Cl2N4S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 4-amino-7-(3,4-dichlorophenyl)-3,5-diphenylpyrrolo[2,3-d]pyrimidine-2-thione |
| SMILES | Nc1c2c(-c3ccccc3)cn(-c3ccc(Cl)c(Cl)c3)c2nc(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C24H16Cl2N4S/c25-19-12-11-17(13-20(19)26)29-14-18(15-7-3-1-4-8-15)21-22(27)30(24(31)28-23(21)29)16-9-5-2-6-10-16/h1-14H,27H2 |
| InChIKey | MVSQKWQAMUSTRH-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|