C13H14BrN2PSe — CID 46837361
12-(bromomethyl)-12-selanylidene-10,14-diaza-12λ5-phosphatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene (PubChem CID 46837361) has the molecular formula C13H14BrN2PSe and a molecular weight of 388.11 g/mol. Its IUPAC name is 12-(bromomethyl)-12-selanylidene-10,14-diaza-12λ5-phosphatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene.
| Compound Name | 12-(bromomethyl)-12-selanylidene-10,14-diaza-12λ5-phosphatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene |
|---|---|
| PubChem CID | 46837361 |
| Molecular Formula | C13H14BrN2PSe |
| Molecular Weight | 388.11 g/mol |
| Exact Mass | 387.92 |
| IUPAC Name | 12-(bromomethyl)-12-selanylidene-10,14-diaza-12λ5-phosphatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene |
| SMILES | [Se]=P1(CBr)CNc2cccc3cccc(c23)NC1 |
| InChI | InChI=1S/C13H14BrN2PSe/c14-7-17(18)8-15-11-5-1-3-10-4-2-6-12(13(10)11)16-9-17/h1-6,15-16H,7-9H2 |
| InChIKey | PRFJQCFBKTXAQY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.11 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|