C27H41BrO3 — CID 46837457
[(3S)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentyl] 4-bromobenzoate (PubChem CID 46837457) has the molecular formula C27H41BrO3 and a molecular weight of 493.53 g/mol. Its IUPAC name is [(3S)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentyl] 4-bromobenzoate.
| Compound Name | [(3S)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 46837457 |
| Molecular Formula | C27H41BrO3 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | [(3S)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentyl] 4-bromobenzoate |
| SMILES | C[C@H](CCOC(=O)c1ccc(Br)cc1)CC[C@@H]1[C@@]2(C)CCCC(C)(C)[C@@H]2CC[C@@]1(C)O |
| InChI | InChI=1S/C27H41BrO3/c1-19(14-18-31-24(29)20-8-10-21(28)11-9-20)7-12-23-26(4)16-6-15-25(2,3)22(26)13-17-27(23,5)30/h8-11,19,22-23,30H,6-7,12-18H2,1-5H3/t19-,22-,23+,26-,27+/m0/s1 |
| InChIKey | ILCHROVAJUIJCI-OFEMSCMUSA-N |
| XLogP | 7.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |