About [[3-[1-(methoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-methoxycarbamate
[[3-[1-(methoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-methoxycarbamate (PubChem CID 46837462) has the molecular formula C19H22N2O5
and a molecular weight of 358.39 g/mol. Its IUPAC name is [[3-[1-(methoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-methoxycarbamate.
Molecular Properties
| Compound Name | [[3-[1-(methoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-methoxycarbamate |
| PubChem CID | 46837462 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [[3-[1-(methoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-methoxycarbamate |
| SMILES | CONC(=O)OC(c1ccccc1)c1cccc(C(C)C(=O)NOC)c1 |
| InChI | InChI=1S/C19H22N2O5/c1-13(18(22)20-24-2)15-10-7-11-16(12-15)17(26-19(23)21-25-3)14-8-5-4-6-9-14/h4-13,17H,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | TXLUVNBOLSPGOX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[3-[1-(methoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-methoxycarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[3-[1-(methoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-methoxycarbamate?
The IUPAC name of [[3-[1-(methoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-methoxycarbamate (CID 46837462) is [[3-[1-(methoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-methoxycarbamate.
What is the SMILES notation for [[3-[1-(methoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-methoxycarbamate?
The canonical SMILES for [[3-[1-(methoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-methoxycarbamate is CONC(=O)OC(c1ccccc1)c1cccc(C(C)C(=O)NOC)c1.
What is the InChIKey of [[3-[1-(methoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-methoxycarbamate?
The InChIKey is TXLUVNBOLSPGOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O5/c1-13(18(22)20-24-2)15-10-7-11-16(12-15)17(26-19(23)21-25-3)14-8-5-4-6-9-14/h4-13,17H,1-3H3,(H,20,22)(H,21,23).
What are the key properties of [[3-[1-(methoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-methoxycarbamate?
[[3-[1-(methoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-methoxycarbamate has a molecular weight of 358.39 g/mol, XLogP of 2.84, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[3-[1-(methoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-methoxycarbamate is sourced from PubChem (CID 46837462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).