About [[3-[1-(ethoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-ethoxycarbamate
[[3-[1-(ethoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-ethoxycarbamate (PubChem CID 46837587) has the molecular formula C21H26N2O5
and a molecular weight of 386.45 g/mol. Its IUPAC name is [[3-[1-(ethoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-ethoxycarbamate.
Molecular Properties
| Compound Name | [[3-[1-(ethoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-ethoxycarbamate |
| PubChem CID | 46837587 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | [[3-[1-(ethoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-ethoxycarbamate |
| SMILES | CCONC(=O)OC(c1ccccc1)c1cccc(C(C)C(=O)NOCC)c1 |
| InChI | InChI=1S/C21H26N2O5/c1-4-26-22-20(24)15(3)17-12-9-13-18(14-17)19(16-10-7-6-8-11-16)28-21(25)23-27-5-2/h6-15,19H,4-5H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | MQRCQKIPAZHXJO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[3-[1-(ethoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-ethoxycarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[3-[1-(ethoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-ethoxycarbamate?
The IUPAC name of [[3-[1-(ethoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-ethoxycarbamate (CID 46837587) is [[3-[1-(ethoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-ethoxycarbamate.
What is the SMILES notation for [[3-[1-(ethoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-ethoxycarbamate?
The canonical SMILES for [[3-[1-(ethoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-ethoxycarbamate is CCONC(=O)OC(c1ccccc1)c1cccc(C(C)C(=O)NOCC)c1.
What is the InChIKey of [[3-[1-(ethoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-ethoxycarbamate?
The InChIKey is MQRCQKIPAZHXJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O5/c1-4-26-22-20(24)15(3)17-12-9-13-18(14-17)19(16-10-7-6-8-11-16)28-21(25)23-27-5-2/h6-15,19H,4-5H2,1-3H3,(H,22,24)(H,23,25).
What are the key properties of [[3-[1-(ethoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-ethoxycarbamate?
[[3-[1-(ethoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-ethoxycarbamate has a molecular weight of 386.45 g/mol, XLogP of 3.62, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[3-[1-(ethoxyamino)-1-oxopropan-2-yl]phenyl]-phenylmethyl] N-ethoxycarbamate is sourced from PubChem (CID 46837587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).