C13H19NO2 — CID 46837647
(2S,3S)-3,5,5-trimethyl-2-phenylmorpholin-2-ol (PubChem CID 46837647) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (2S,3S)-3,5,5-trimethyl-2-phenylmorpholin-2-ol.
| Compound Name | (2S,3S)-3,5,5-trimethyl-2-phenylmorpholin-2-ol |
|---|---|
| PubChem CID | 46837647 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (2S,3S)-3,5,5-trimethyl-2-phenylmorpholin-2-ol |
| SMILES | C[C@@H]1NC(C)(C)CO[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C13H19NO2/c1-10-13(15,11-7-5-4-6-8-11)16-9-12(2,3)14-10/h4-8,10,14-15H,9H2,1-3H3/t10-,13+/m0/s1 |
| InChIKey | NGHJSSNVKXEBAB-GXFFZTMASA-N |
| XLogP | 1.62 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |