C13H18FNO2 — CID 46837653
(2S,3S)-2-(4-fluorophenyl)-3,5,5-trimethylmorpholin-2-ol (PubChem CID 46837653) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is (2S,3S)-2-(4-fluorophenyl)-3,5,5-trimethylmorpholin-2-ol.
| Compound Name | (2S,3S)-2-(4-fluorophenyl)-3,5,5-trimethylmorpholin-2-ol |
|---|---|
| PubChem CID | 46837653 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (2S,3S)-2-(4-fluorophenyl)-3,5,5-trimethylmorpholin-2-ol |
| SMILES | C[C@@H]1NC(C)(C)CO[C@@]1(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FNO2/c1-9-13(16,17-8-12(2,3)15-9)10-4-6-11(14)7-5-10/h4-7,9,15-16H,8H2,1-3H3/t9-,13+/m0/s1 |
| InChIKey | SXEGCINDYXTNFI-TVQRCGJNSA-N |
| XLogP | 1.76 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |