About [[3-(1-oxo-1-piperidin-1-ylpropan-2-yl)phenyl]-phenylmethyl] piperidine-1-carboxylate
[[3-(1-oxo-1-piperidin-1-ylpropan-2-yl)phenyl]-phenylmethyl] piperidine-1-carboxylate (PubChem CID 46837727) has the molecular formula C27H34N2O3
and a molecular weight of 434.58 g/mol. Its IUPAC name is [[3-(1-oxo-1-piperidin-1-ylpropan-2-yl)phenyl]-phenylmethyl] piperidine-1-carboxylate.
Molecular Properties
| Compound Name | [[3-(1-oxo-1-piperidin-1-ylpropan-2-yl)phenyl]-phenylmethyl] piperidine-1-carboxylate |
| PubChem CID | 46837727 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | [[3-(1-oxo-1-piperidin-1-ylpropan-2-yl)phenyl]-phenylmethyl] piperidine-1-carboxylate |
| SMILES | CC(C(=O)N1CCCCC1)c1cccc(C(OC(=O)N2CCCCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H34N2O3/c1-21(26(30)28-16-7-3-8-17-28)23-14-11-15-24(20-23)25(22-12-5-2-6-13-22)32-27(31)29-18-9-4-10-19-29/h2,5-6,11-15,20-21,25H,3-4,7-10,16-19H2,1H3 |
| InChIKey | JKVXZJSDKJBYOM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [[3-(1-oxo-1-piperidin-1-ylpropan-2-yl)phenyl]-phenylmethyl] piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[3-(1-oxo-1-piperidin-1-ylpropan-2-yl)phenyl]-phenylmethyl] piperidine-1-carboxylate?
The IUPAC name of [[3-(1-oxo-1-piperidin-1-ylpropan-2-yl)phenyl]-phenylmethyl] piperidine-1-carboxylate (CID 46837727) is [[3-(1-oxo-1-piperidin-1-ylpropan-2-yl)phenyl]-phenylmethyl] piperidine-1-carboxylate.
What is the SMILES notation for [[3-(1-oxo-1-piperidin-1-ylpropan-2-yl)phenyl]-phenylmethyl] piperidine-1-carboxylate?
The canonical SMILES for [[3-(1-oxo-1-piperidin-1-ylpropan-2-yl)phenyl]-phenylmethyl] piperidine-1-carboxylate is CC(C(=O)N1CCCCC1)c1cccc(C(OC(=O)N2CCCCC2)c2ccccc2)c1.
What is the InChIKey of [[3-(1-oxo-1-piperidin-1-ylpropan-2-yl)phenyl]-phenylmethyl] piperidine-1-carboxylate?
The InChIKey is JKVXZJSDKJBYOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H34N2O3/c1-21(26(30)28-16-7-3-8-17-28)23-14-11-15-24(20-23)25(22-12-5-2-6-13-22)32-27(31)29-18-9-4-10-19-29/h2,5-6,11-15,20-21,25H,3-4,7-10,16-19H2,1H3.
What are the key properties of [[3-(1-oxo-1-piperidin-1-ylpropan-2-yl)phenyl]-phenylmethyl] piperidine-1-carboxylate?
[[3-(1-oxo-1-piperidin-1-ylpropan-2-yl)phenyl]-phenylmethyl] piperidine-1-carboxylate has a molecular weight of 434.58 g/mol, XLogP of 5.51, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[3-(1-oxo-1-piperidin-1-ylpropan-2-yl)phenyl]-phenylmethyl] piperidine-1-carboxylate is sourced from PubChem (CID 46837727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).