About 2-[[(E)-2-(benzenesulfonyl)ethenyl]sulfonylmethyl]-4,5-dihydro-1,3-oxazole
2-[[(E)-2-(benzenesulfonyl)ethenyl]sulfonylmethyl]-4,5-dihydro-1,3-oxazole (PubChem CID 46837730) has the molecular formula C12H13NO5S2
and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-[[(E)-2-(benzenesulfonyl)ethenyl]sulfonylmethyl]-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[[(E)-2-(benzenesulfonyl)ethenyl]sulfonylmethyl]-4,5-dihydro-1,3-oxazole |
| PubChem CID | 46837730 |
| Molecular Formula | C12H13NO5S2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 2-[[(E)-2-(benzenesulfonyl)ethenyl]sulfonylmethyl]-4,5-dihydro-1,3-oxazole |
| SMILES | O=S(=O)(/C=C/S(=O)(=O)c1ccccc1)CC1=NCCO1 |
| InChI | InChI=1S/C12H13NO5S2/c14-19(15,10-12-13-6-7-18-12)8-9-20(16,17)11-4-2-1-3-5-11/h1-5,8-9H,6-7,10H2/b9-8+ |
| InChIKey | RZUDLDTZSSWHBU-CMDGGOBGSA-N |
| XLogP | 0.77 |
| TPSA | 89.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[(E)-2-(benzenesulfonyl)ethenyl]sulfonylmethyl]-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(E)-2-(benzenesulfonyl)ethenyl]sulfonylmethyl]-4,5-dihydro-1,3-oxazole?
The IUPAC name of 2-[[(E)-2-(benzenesulfonyl)ethenyl]sulfonylmethyl]-4,5-dihydro-1,3-oxazole (CID 46837730) is 2-[[(E)-2-(benzenesulfonyl)ethenyl]sulfonylmethyl]-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 2-[[(E)-2-(benzenesulfonyl)ethenyl]sulfonylmethyl]-4,5-dihydro-1,3-oxazole?
The canonical SMILES for 2-[[(E)-2-(benzenesulfonyl)ethenyl]sulfonylmethyl]-4,5-dihydro-1,3-oxazole is O=S(=O)(/C=C/S(=O)(=O)c1ccccc1)CC1=NCCO1.
What is the InChIKey of 2-[[(E)-2-(benzenesulfonyl)ethenyl]sulfonylmethyl]-4,5-dihydro-1,3-oxazole?
The InChIKey is RZUDLDTZSSWHBU-CMDGGOBGSA-N. The full InChI is InChI=1S/C12H13NO5S2/c14-19(15,10-12-13-6-7-18-12)8-9-20(16,17)11-4-2-1-3-5-11/h1-5,8-9H,6-7,10H2/b9-8+.
What are the key properties of 2-[[(E)-2-(benzenesulfonyl)ethenyl]sulfonylmethyl]-4,5-dihydro-1,3-oxazole?
2-[[(E)-2-(benzenesulfonyl)ethenyl]sulfonylmethyl]-4,5-dihydro-1,3-oxazole has a molecular weight of 315.37 g/mol, XLogP of 0.77, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(E)-2-(benzenesulfonyl)ethenyl]sulfonylmethyl]-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 46837730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).