C14H21NO2 — CID 46837781
(2S,3S)-3,5,5-trimethyl-2-(4-methylphenyl)morpholin-2-ol (PubChem CID 46837781) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (2S,3S)-3,5,5-trimethyl-2-(4-methylphenyl)morpholin-2-ol.
| Compound Name | (2S,3S)-3,5,5-trimethyl-2-(4-methylphenyl)morpholin-2-ol |
|---|---|
| PubChem CID | 46837781 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (2S,3S)-3,5,5-trimethyl-2-(4-methylphenyl)morpholin-2-ol |
| SMILES | Cc1ccc([C@]2(O)OCC(C)(C)N[C@H]2C)cc1 |
| InChI | InChI=1S/C14H21NO2/c1-10-5-7-12(8-6-10)14(16)11(2)15-13(3,4)9-17-14/h5-8,11,15-16H,9H2,1-4H3/t11-,14+/m0/s1 |
| InChIKey | PLVMDZQEFNUCOF-SMDDNHRTSA-N |
| XLogP | 1.93 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |