C19H23NO2 — CID 46837783
(2S,3S)-3,5,5-trimethyl-2-(4-phenylphenyl)morpholin-2-ol (PubChem CID 46837783) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2S,3S)-3,5,5-trimethyl-2-(4-phenylphenyl)morpholin-2-ol.
| Compound Name | (2S,3S)-3,5,5-trimethyl-2-(4-phenylphenyl)morpholin-2-ol |
|---|---|
| PubChem CID | 46837783 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (2S,3S)-3,5,5-trimethyl-2-(4-phenylphenyl)morpholin-2-ol |
| SMILES | C[C@@H]1NC(C)(C)CO[C@@]1(O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-14-19(21,22-13-18(2,3)20-14)17-11-9-16(10-12-17)15-7-5-4-6-8-15/h4-12,14,20-21H,13H2,1-3H3/t14-,19+/m0/s1 |
| InChIKey | CWQJTYANMLPKAM-IFXJQAMLSA-N |
| XLogP | 3.29 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |