About 2-[[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylmethyl]-4,5-dihydro-1,3-thiazole
2-[[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylmethyl]-4,5-dihydro-1,3-thiazole (PubChem CID 46837865) has the molecular formula C13H15NO4S3
and a molecular weight of 345.47 g/mol. Its IUPAC name is 2-[[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylmethyl]-4,5-dihydro-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylmethyl]-4,5-dihydro-1,3-thiazole |
| PubChem CID | 46837865 |
| Molecular Formula | C13H15NO4S3 |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 2-[[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylmethyl]-4,5-dihydro-1,3-thiazole |
| SMILES | Cc1ccc(S(=O)(=O)/C=C/S(=O)(=O)CC2=NCCS2)cc1 |
| InChI | InChI=1S/C13H15NO4S3/c1-11-2-4-12(5-3-11)21(17,18)9-8-20(15,16)10-13-14-6-7-19-13/h2-5,8-9H,6-7,10H2,1H3/b9-8+ |
| InChIKey | RQOYBZBJBXCFJX-CMDGGOBGSA-N |
| XLogP | 1.80 |
| TPSA | 80.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylmethyl]-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylmethyl]-4,5-dihydro-1,3-thiazole?
The IUPAC name of 2-[[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylmethyl]-4,5-dihydro-1,3-thiazole (CID 46837865) is 2-[[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylmethyl]-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for 2-[[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylmethyl]-4,5-dihydro-1,3-thiazole?
The canonical SMILES for 2-[[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylmethyl]-4,5-dihydro-1,3-thiazole is Cc1ccc(S(=O)(=O)/C=C/S(=O)(=O)CC2=NCCS2)cc1.
What is the InChIKey of 2-[[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylmethyl]-4,5-dihydro-1,3-thiazole?
The InChIKey is RQOYBZBJBXCFJX-CMDGGOBGSA-N. The full InChI is InChI=1S/C13H15NO4S3/c1-11-2-4-12(5-3-11)21(17,18)9-8-20(15,16)10-13-14-6-7-19-13/h2-5,8-9H,6-7,10H2,1H3/b9-8+.
What are the key properties of 2-[[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylmethyl]-4,5-dihydro-1,3-thiazole?
2-[[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylmethyl]-4,5-dihydro-1,3-thiazole has a molecular weight of 345.47 g/mol, XLogP of 1.80, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylmethyl]-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 46837865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).