About (2S,3S)-2-(3-chlorophenyl)-3-ethyl-5,5-dimethylmorpholin-2-ol
(2S,3S)-2-(3-chlorophenyl)-3-ethyl-5,5-dimethylmorpholin-2-ol (PubChem CID 46837922) has the molecular formula C14H20ClNO2
and a molecular weight of 269.77 g/mol. Its IUPAC name is (2S,3S)-2-(3-chlorophenyl)-3-ethyl-5,5-dimethylmorpholin-2-ol.
Molecular Properties
| Compound Name | (2S,3S)-2-(3-chlorophenyl)-3-ethyl-5,5-dimethylmorpholin-2-ol |
| PubChem CID | 46837922 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (2S,3S)-2-(3-chlorophenyl)-3-ethyl-5,5-dimethylmorpholin-2-ol |
| SMILES | CC[C@@H]1NC(C)(C)CO[C@@]1(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H20ClNO2/c1-4-12-14(17,18-9-13(2,3)16-12)10-6-5-7-11(15)8-10/h5-8,12,16-17H,4,9H2,1-3H3/t12-,14-/m0/s1 |
| InChIKey | LYDZRRKPDGFEON-JSGCOSHPSA-N |
| XLogP | 2.66 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3S)-2-(3-chlorophenyl)-3-ethyl-5,5-dimethylmorpholin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-(3-chlorophenyl)-3-ethyl-5,5-dimethylmorpholin-2-ol?
The IUPAC name of (2S,3S)-2-(3-chlorophenyl)-3-ethyl-5,5-dimethylmorpholin-2-ol (CID 46837922) is (2S,3S)-2-(3-chlorophenyl)-3-ethyl-5,5-dimethylmorpholin-2-ol.
What is the SMILES notation for (2S,3S)-2-(3-chlorophenyl)-3-ethyl-5,5-dimethylmorpholin-2-ol?
The canonical SMILES for (2S,3S)-2-(3-chlorophenyl)-3-ethyl-5,5-dimethylmorpholin-2-ol is CC[C@@H]1NC(C)(C)CO[C@@]1(O)c1cccc(Cl)c1.
What is the InChIKey of (2S,3S)-2-(3-chlorophenyl)-3-ethyl-5,5-dimethylmorpholin-2-ol?
The InChIKey is LYDZRRKPDGFEON-JSGCOSHPSA-N. The full InChI is InChI=1S/C14H20ClNO2/c1-4-12-14(17,18-9-13(2,3)16-12)10-6-5-7-11(15)8-10/h5-8,12,16-17H,4,9H2,1-3H3/t12-,14-/m0/s1.
What are the key properties of (2S,3S)-2-(3-chlorophenyl)-3-ethyl-5,5-dimethylmorpholin-2-ol?
(2S,3S)-2-(3-chlorophenyl)-3-ethyl-5,5-dimethylmorpholin-2-ol has a molecular weight of 269.77 g/mol, XLogP of 2.66, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-(3-chlorophenyl)-3-ethyl-5,5-dimethylmorpholin-2-ol is sourced from PubChem (CID 46837922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).