C15H22ClNO2 — CID 46837923
(2S,3S)-2-(3-chlorophenyl)-5,5-dimethyl-3-propylmorpholin-2-ol (PubChem CID 46837923) has the molecular formula C15H22ClNO2 and a molecular weight of 283.80 g/mol. Its IUPAC name is (2S,3S)-2-(3-chlorophenyl)-5,5-dimethyl-3-propylmorpholin-2-ol.
| Compound Name | (2S,3S)-2-(3-chlorophenyl)-5,5-dimethyl-3-propylmorpholin-2-ol |
|---|---|
| PubChem CID | 46837923 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | (2S,3S)-2-(3-chlorophenyl)-5,5-dimethyl-3-propylmorpholin-2-ol |
| SMILES | CCC[C@@H]1NC(C)(C)CO[C@@]1(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H22ClNO2/c1-4-6-13-15(18,19-10-14(2,3)17-13)11-7-5-8-12(16)9-11/h5,7-9,13,17-18H,4,6,10H2,1-3H3/t13-,15-/m0/s1 |
| InChIKey | ZWMHSADWUIOURG-ZFWWWQNUSA-N |
| XLogP | 3.05 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |