C14H20ClNO2 — CID 46837924
(2S,3S)-2-(3-chlorophenyl)-3,4,5,5-tetramethylmorpholin-2-ol (PubChem CID 46837924) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is (2S,3S)-2-(3-chlorophenyl)-3,4,5,5-tetramethylmorpholin-2-ol.
| Compound Name | (2S,3S)-2-(3-chlorophenyl)-3,4,5,5-tetramethylmorpholin-2-ol |
|---|---|
| PubChem CID | 46837924 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (2S,3S)-2-(3-chlorophenyl)-3,4,5,5-tetramethylmorpholin-2-ol |
| SMILES | C[C@@H]1N(C)C(C)(C)CO[C@@]1(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H20ClNO2/c1-10-14(17,11-6-5-7-12(15)8-11)18-9-13(2,3)16(10)4/h5-8,10,17H,9H2,1-4H3/t10-,14+/m0/s1 |
| InChIKey | KHVUFWSEOLNUFN-IINYFYTJSA-N |
| XLogP | 2.61 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |