C27H28F3NO2 — CID 46837971
ethyl (3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-[4-(trifluoromethyl)phenyl]propanoate (PubChem CID 46837971) has the molecular formula C27H28F3NO2 and a molecular weight of 455.52 g/mol. Its IUPAC name is ethyl (3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-[4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl (3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-[4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 46837971 |
| Molecular Formula | C27H28F3NO2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | ethyl (3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-[4-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)C[C@@H](c1ccc(C(F)(F)F)cc1)N(Cc1ccccc1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C27H28F3NO2/c1-3-33-26(32)18-25(23-14-16-24(17-15-23)27(28,29)30)31(19-21-10-6-4-7-11-21)20(2)22-12-8-5-9-13-22/h4-17,20,25H,3,18-19H2,1-2H3/t20-,25+/m1/s1 |
| InChIKey | GFPJXXZTKXCRTC-NLFFAJNJSA-N |
| XLogP | 6.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |