C17H19NO6 — CID 46838080
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-pyridin-3-ylphenoxy)oxane-3,4,5-triol (PubChem CID 46838080) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-pyridin-3-ylphenoxy)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-pyridin-3-ylphenoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46838080 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-pyridin-3-ylphenoxy)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](Oc2ccc(-c3cccnc3)cc2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H19NO6/c19-9-13-14(20)15(21)16(22)17(24-13)23-12-5-3-10(4-6-12)11-2-1-7-18-8-11/h1-8,13-17,19-22H,9H2/t13-,14-,15+,16+,17+/m1/s1 |
| InChIKey | ATUZXONKXZYYHX-NRKLIOEPSA-N |
| XLogP | -0.07 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |