C17H21NO4 — CID 46838370
benzyl 6-prop-2-enyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylate (PubChem CID 46838370) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is benzyl 6-prop-2-enyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylate.
| Compound Name | benzyl 6-prop-2-enyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylate |
|---|---|
| PubChem CID | 46838370 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | benzyl 6-prop-2-enyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylate |
| SMILES | C=CCC1N(C(=O)OCc2ccccc2)CCC12OCCO2 |
| InChI | InChI=1S/C17H21NO4/c1-2-6-15-17(21-11-12-22-17)9-10-18(15)16(19)20-13-14-7-4-3-5-8-14/h2-5,7-8,15H,1,6,9-13H2 |
| InChIKey | HNHCAOWOSGDRQM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|