C19H22O7 — CID 46838483
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[4-(3-methoxyphenyl)phenoxy]oxane-3,4,5-triol (PubChem CID 46838483) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[4-(3-methoxyphenyl)phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[4-(3-methoxyphenyl)phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46838483 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[4-(3-methoxyphenyl)phenoxy]oxane-3,4,5-triol |
| SMILES | COc1cccc(-c2ccc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc2)c1 |
| InChI | InChI=1S/C19H22O7/c1-24-14-4-2-3-12(9-14)11-5-7-13(8-6-11)25-19-18(23)17(22)16(21)15(10-20)26-19/h2-9,15-23H,10H2,1H3/t15-,16-,17+,18+,19+/m1/s1 |
| InChIKey | KGDFNVWSXATYLI-GFEQUFNTSA-N |
| XLogP | 0.54 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |