About 3-benzyl-6-bromo-1,3-benzoxazine-2,4-dithione
3-benzyl-6-bromo-1,3-benzoxazine-2,4-dithione (PubChem CID 46838520) has the molecular formula C15H10BrNOS2
and a molecular weight of 364.29 g/mol. Its IUPAC name is 3-benzyl-6-bromo-1,3-benzoxazine-2,4-dithione.
Molecular Properties
| Compound Name | 3-benzyl-6-bromo-1,3-benzoxazine-2,4-dithione |
| PubChem CID | 46838520 |
| Molecular Formula | C15H10BrNOS2 |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | 3-benzyl-6-bromo-1,3-benzoxazine-2,4-dithione |
| SMILES | S=c1oc2ccc(Br)cc2c(=S)n1Cc1ccccc1 |
| InChI | InChI=1S/C15H10BrNOS2/c16-11-6-7-13-12(8-11)14(19)17(15(20)18-13)9-10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | MVXOKOVYKZGWJK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-6-bromo-1,3-benzoxazine-2,4-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-6-bromo-1,3-benzoxazine-2,4-dithione?
The IUPAC name of 3-benzyl-6-bromo-1,3-benzoxazine-2,4-dithione (CID 46838520) is 3-benzyl-6-bromo-1,3-benzoxazine-2,4-dithione.
What is the SMILES notation for 3-benzyl-6-bromo-1,3-benzoxazine-2,4-dithione?
The canonical SMILES for 3-benzyl-6-bromo-1,3-benzoxazine-2,4-dithione is S=c1oc2ccc(Br)cc2c(=S)n1Cc1ccccc1.
What is the InChIKey of 3-benzyl-6-bromo-1,3-benzoxazine-2,4-dithione?
The InChIKey is MVXOKOVYKZGWJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrNOS2/c16-11-6-7-13-12(8-11)14(19)17(15(20)18-13)9-10-4-2-1-3-5-10/h1-8H,9H2.
What are the key properties of 3-benzyl-6-bromo-1,3-benzoxazine-2,4-dithione?
3-benzyl-6-bromo-1,3-benzoxazine-2,4-dithione has a molecular weight of 364.29 g/mol, XLogP of 5.50, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-6-bromo-1,3-benzoxazine-2,4-dithione is sourced from PubChem (CID 46838520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).