C19H21NO7 — CID 46838627
3-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzamide (PubChem CID 46838627) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is 3-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzamide.
| Compound Name | 3-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzamide |
|---|---|
| PubChem CID | 46838627 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 3-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzamide |
| SMILES | NC(=O)c1cccc(-c2ccc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc2)c1 |
| InChI | InChI=1S/C19H21NO7/c20-18(25)12-3-1-2-11(8-12)10-4-6-13(7-5-10)26-19-17(24)16(23)15(22)14(9-21)27-19/h1-8,14-17,19,21-24H,9H2,(H2,20,25)/t14-,15-,16+,17+,19+/m1/s1 |
| InChIKey | YPLRTLOSTFWOTD-GJGATLCTSA-N |
| XLogP | -0.37 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |