C18H19FO6 — CID 46838630
(2R,3S,4S,5S,6R)-2-[4-(3-fluorophenyl)phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 46838630) has the molecular formula C18H19FO6 and a molecular weight of 350.34 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-[4-(3-fluorophenyl)phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-[4-(3-fluorophenyl)phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46838630 |
| Molecular Formula | C18H19FO6 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-[4-(3-fluorophenyl)phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](Oc2ccc(-c3cccc(F)c3)cc2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H19FO6/c19-12-3-1-2-11(8-12)10-4-6-13(7-5-10)24-18-17(23)16(22)15(21)14(9-20)25-18/h1-8,14-18,20-23H,9H2/t14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | BOMNBJCDHMOMJI-ZBRFXRBCSA-N |
| XLogP | 0.67 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |