C17H21F2NO3S — CID 46838894
methyl (2R,4R)-2-tert-butyl-4-[(3,5-difluorophenyl)methyl]-3-formyl-1,3-thiazolidine-4-carboxylate (PubChem CID 46838894) has the molecular formula C17H21F2NO3S and a molecular weight of 357.42 g/mol. Its IUPAC name is methyl (2R,4R)-2-tert-butyl-4-[(3,5-difluorophenyl)methyl]-3-formyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl (2R,4R)-2-tert-butyl-4-[(3,5-difluorophenyl)methyl]-3-formyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 46838894 |
| Molecular Formula | C17H21F2NO3S |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | methyl (2R,4R)-2-tert-butyl-4-[(3,5-difluorophenyl)methyl]-3-formyl-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)[C@]1(Cc2cc(F)cc(F)c2)CS[C@H](C(C)(C)C)N1C=O |
| InChI | InChI=1S/C17H21F2NO3S/c1-16(2,3)14-20(10-21)17(9-24-14,15(22)23-4)8-11-5-12(18)7-13(19)6-11/h5-7,10,14H,8-9H2,1-4H3/t14-,17+/m1/s1 |
| InChIKey | WXSCUVMINNTOOG-PBHICJAKSA-N |
| XLogP | 3.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|