C35H32N2O4 — CID 46838939
2-[4-[(4,5,15,16-tetramethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaen-8-yl)methyl]phenyl]benzonitrile (PubChem CID 46838939) has the molecular formula C35H32N2O4 and a molecular weight of 544.65 g/mol. Its IUPAC name is 2-[4-[(4,5,15,16-tetramethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaen-8-yl)methyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[(4,5,15,16-tetramethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaen-8-yl)methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 46838939 |
| Molecular Formula | C35H32N2O4 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 2-[4-[(4,5,15,16-tetramethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaen-8-yl)methyl]phenyl]benzonitrile |
| SMILES | COc1cc2c(Cc3ccc(-c4ccccc4C#N)cc3)c3c4c(cc(OC)c(OC)c4c2cc1OC)CCN3C |
| InChI | InChI=1S/C35H32N2O4/c1-37-15-14-23-17-31(40-4)35(41-5)33-27-19-30(39-3)29(38-2)18-26(27)28(34(37)32(23)33)16-21-10-12-22(13-11-21)25-9-7-6-8-24(25)20-36/h6-13,17-19H,14-16H2,1-5H3 |
| InChIKey | SJLYDSOJPVGCQU-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|