C11H15NO3S — CID 4683894
2-(benzenesulfonyl)-N-propylacetamide (PubChem CID 4683894) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-N-propylacetamide.
| Compound Name | 2-(benzenesulfonyl)-N-propylacetamide |
|---|---|
| PubChem CID | 4683894 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 2-(benzenesulfonyl)-N-propylacetamide |
| SMILES | CCCNC(=O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H15NO3S/c1-2-8-12-11(13)9-16(14,15)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H,12,13) |
| InChIKey | BOKBYGWFGVUJCP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |