About 2-amino-6-[(3,4-dichlorophenyl)methylsulfanyl]-4-thiophen-3-ylpyridine-3,5-dicarbonitrile
2-amino-6-[(3,4-dichlorophenyl)methylsulfanyl]-4-thiophen-3-ylpyridine-3,5-dicarbonitrile (PubChem CID 46838965) has the molecular formula C18H10Cl2N4S2
and a molecular weight of 417.35 g/mol. Its IUPAC name is 2-amino-6-[(3,4-dichlorophenyl)methylsulfanyl]-4-thiophen-3-ylpyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-amino-6-[(3,4-dichlorophenyl)methylsulfanyl]-4-thiophen-3-ylpyridine-3,5-dicarbonitrile |
| PubChem CID | 46838965 |
| Molecular Formula | C18H10Cl2N4S2 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 415.97 |
| IUPAC Name | 2-amino-6-[(3,4-dichlorophenyl)methylsulfanyl]-4-thiophen-3-ylpyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)nc(SCc2ccc(Cl)c(Cl)c2)c(C#N)c1-c1ccsc1 |
| InChI | InChI=1S/C18H10Cl2N4S2/c19-14-2-1-10(5-15(14)20)8-26-18-13(7-22)16(11-3-4-25-9-11)12(6-21)17(23)24-18/h1-5,9H,8H2,(H2,23,24) |
| InChIKey | WVNIWPJQIRDAOS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-6-[(3,4-dichlorophenyl)methylsulfanyl]-4-thiophen-3-ylpyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-[(3,4-dichlorophenyl)methylsulfanyl]-4-thiophen-3-ylpyridine-3,5-dicarbonitrile?
The IUPAC name of 2-amino-6-[(3,4-dichlorophenyl)methylsulfanyl]-4-thiophen-3-ylpyridine-3,5-dicarbonitrile (CID 46838965) is 2-amino-6-[(3,4-dichlorophenyl)methylsulfanyl]-4-thiophen-3-ylpyridine-3,5-dicarbonitrile.
What is the SMILES notation for 2-amino-6-[(3,4-dichlorophenyl)methylsulfanyl]-4-thiophen-3-ylpyridine-3,5-dicarbonitrile?
The canonical SMILES for 2-amino-6-[(3,4-dichlorophenyl)methylsulfanyl]-4-thiophen-3-ylpyridine-3,5-dicarbonitrile is N#Cc1c(N)nc(SCc2ccc(Cl)c(Cl)c2)c(C#N)c1-c1ccsc1.
What is the InChIKey of 2-amino-6-[(3,4-dichlorophenyl)methylsulfanyl]-4-thiophen-3-ylpyridine-3,5-dicarbonitrile?
The InChIKey is WVNIWPJQIRDAOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10Cl2N4S2/c19-14-2-1-10(5-15(14)20)8-26-18-13(7-22)16(11-3-4-25-9-11)12(6-21)17(23)24-18/h1-5,9H,8H2,(H2,23,24).
What are the key properties of 2-amino-6-[(3,4-dichlorophenyl)methylsulfanyl]-4-thiophen-3-ylpyridine-3,5-dicarbonitrile?
2-amino-6-[(3,4-dichlorophenyl)methylsulfanyl]-4-thiophen-3-ylpyridine-3,5-dicarbonitrile has a molecular weight of 417.35 g/mol, XLogP of 5.73, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-[(3,4-dichlorophenyl)methylsulfanyl]-4-thiophen-3-ylpyridine-3,5-dicarbonitrile is sourced from PubChem (CID 46838965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).