C26H36N6O — CID 46839259
1-oxo-2-phenyl-3-(piperidin-1-ylmethylamino)-5-pyrrolidin-1-yl-4a,5,6,7,8,9-hexahydropyrimido[1,6-a]azepine-4-carbonitrile (PubChem CID 46839259) has the molecular formula C26H36N6O and a molecular weight of 448.62 g/mol. Its IUPAC name is 1-oxo-2-phenyl-3-(piperidin-1-ylmethylamino)-5-pyrrolidin-1-yl-4a,5,6,7,8,9-hexahydropyrimido[1,6-a]azepine-4-carbonitrile.
| Compound Name | 1-oxo-2-phenyl-3-(piperidin-1-ylmethylamino)-5-pyrrolidin-1-yl-4a,5,6,7,8,9-hexahydropyrimido[1,6-a]azepine-4-carbonitrile |
|---|---|
| PubChem CID | 46839259 |
| Molecular Formula | C26H36N6O |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | 1-oxo-2-phenyl-3-(piperidin-1-ylmethylamino)-5-pyrrolidin-1-yl-4a,5,6,7,8,9-hexahydropyrimido[1,6-a]azepine-4-carbonitrile |
| SMILES | N#CC1=C(NCN2CCCCC2)N(c2ccccc2)C(=O)N2CCCCC(N3CCCC3)C12 |
| InChI | InChI=1S/C26H36N6O/c27-19-22-24-23(30-16-9-10-17-30)13-5-8-18-31(24)26(33)32(21-11-3-1-4-12-21)25(22)28-20-29-14-6-2-7-15-29/h1,3-4,11-12,23-24,28H,2,5-10,13-18,20H2 |
| InChIKey | HDWQAMRIXRRWBR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |