C8H7F3O2 — CID 46839264
2-[(E)-3,3,3-trifluoroprop-1-enyl]-2,3-dihydropyran-6-one (PubChem CID 46839264) has the molecular formula C8H7F3O2 and a molecular weight of 192.14 g/mol. Its IUPAC name is 2-[(E)-3,3,3-trifluoroprop-1-enyl]-2,3-dihydropyran-6-one.
| Compound Name | 2-[(E)-3,3,3-trifluoroprop-1-enyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 46839264 |
| Molecular Formula | C8H7F3O2 |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 2-[(E)-3,3,3-trifluoroprop-1-enyl]-2,3-dihydropyran-6-one |
| SMILES | O=C1C=CCC(/C=C/C(F)(F)F)O1 |
| InChI | InChI=1S/C8H7F3O2/c9-8(10,11)5-4-6-2-1-3-7(12)13-6/h1,3-6H,2H2/b5-4+ |
| InChIKey | ZORGVQAZRWYRNP-SNAWJCMRSA-N |
| XLogP | 1.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|