C18H28N2 — CID 46839311
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2,6-dimethylaniline (PubChem CID 46839311) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2,6-dimethylaniline.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 46839311 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2,6-dimethylaniline |
| SMILES | Cc1cccc(C)c1NC[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C18H28N2/c1-14-7-5-8-15(2)18(14)19-13-16-9-6-12-20-11-4-3-10-17(16)20/h5,7-8,16-17,19H,3-4,6,9-13H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | FIMLOFSRPSXWDG-DLBZAZTESA-N |
| XLogP | 3.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |