methyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate

C10H10N2O2 — CID 46839991

IUPACmethyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate
SMILESCOC(=O)c1cc2cccnc2n1C
InChIInChI=1S/C10H10N2O2/c1-12-8(10(13)14-2)6-7-4-3-5-11-9(7)12/h3-6H,1-2H3
InChIKeyYHZKMMZEVYGRQA-UHFFFAOYSA-N
MW190.20 g/mol
LogP1.36
Rot. Bonds1

About methyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate

methyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate (PubChem CID 46839991) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is methyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate
PubChem CID46839991
Molecular FormulaC10H10N2O2
Molecular Weight190.20 g/mol
Exact Mass190.07
IUPAC Namemethyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate
SMILESCOC(=O)c1cc2cccnc2n1C
InChIInChI=1S/C10H10N2O2/c1-12-8(10(13)14-2)6-7-4-3-5-11-9(7)12/h3-6H,1-2H3
InChIKeyYHZKMMZEVYGRQA-UHFFFAOYSA-N
XLogP1.36
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.20
LogP ≤ 51.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate?
The IUPAC name of methyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate (CID 46839991) is methyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate.
What is the SMILES notation for methyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate?
The canonical SMILES for methyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate is COC(=O)c1cc2cccnc2n1C.
What is the InChIKey of methyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate?
The InChIKey is YHZKMMZEVYGRQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-12-8(10(13)14-2)6-7-4-3-5-11-9(7)12/h3-6H,1-2H3.
What are the key properties of methyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate?
methyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate has a molecular weight of 190.20 g/mol, XLogP of 1.36, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-methylpyrrolo[2,3-b]pyridine-2-carboxylate is sourced from PubChem (CID 46839991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).