About tributyl-(2-methyl-1,3-thiazol-5-yl)stannane
tributyl-(2-methyl-1,3-thiazol-5-yl)stannane (PubChem CID 46840005) has the molecular formula C16H31NSSn
and a molecular weight of 388.21 g/mol. Its IUPAC name is tributyl-(2-methyl-1,3-thiazol-5-yl)stannane.
Molecular Properties
| Compound Name | tributyl-(2-methyl-1,3-thiazol-5-yl)stannane |
| PubChem CID | 46840005 |
| Molecular Formula | C16H31NSSn |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | tributyl-(2-methyl-1,3-thiazol-5-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cnc(C)s1 |
| InChI | InChI=1S/C4H4NS.3C4H9.Sn/c1-4-5-2-3-6-4;3*1-3-4-2;/h2H,1H3;3*1,3-4H2,2H3; |
| InChIKey | QBVDGHNBPOLJIZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tributyl-(2-methyl-1,3-thiazol-5-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-(2-methyl-1,3-thiazol-5-yl)stannane?
The IUPAC name of tributyl-(2-methyl-1,3-thiazol-5-yl)stannane (CID 46840005) is tributyl-(2-methyl-1,3-thiazol-5-yl)stannane.
What is the SMILES notation for tributyl-(2-methyl-1,3-thiazol-5-yl)stannane?
The canonical SMILES for tributyl-(2-methyl-1,3-thiazol-5-yl)stannane is CCCC[Sn](CCCC)(CCCC)c1cnc(C)s1.
What is the InChIKey of tributyl-(2-methyl-1,3-thiazol-5-yl)stannane?
The InChIKey is QBVDGHNBPOLJIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4NS.3C4H9.Sn/c1-4-5-2-3-6-4;3*1-3-4-2;/h2H,1H3;3*1,3-4H2,2H3;.
What are the key properties of tributyl-(2-methyl-1,3-thiazol-5-yl)stannane?
tributyl-(2-methyl-1,3-thiazol-5-yl)stannane has a molecular weight of 388.21 g/mol, XLogP of 5.51, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-(2-methyl-1,3-thiazol-5-yl)stannane is sourced from PubChem (CID 46840005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).