About 7-bromo-2,3,4,5-tetrahydro-1H-3-benzazepine
7-bromo-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 46840033) has the molecular formula C10H12BrN
and a molecular weight of 226.12 g/mol. Its IUPAC name is 7-bromo-2,3,4,5-tetrahydro-1H-3-benzazepine.
Molecular Properties
| Compound Name | 7-bromo-2,3,4,5-tetrahydro-1H-3-benzazepine |
| PubChem CID | 46840033 |
| Molecular Formula | C10H12BrN |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 7-bromo-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | Brc1ccc2c(c1)CCNCC2 |
| InChI | InChI=1S/C10H12BrN/c11-10-2-1-8-3-5-12-6-4-9(8)7-10/h1-2,7,12H,3-6H2 |
| InChIKey | ZVNFJSFIRKPMES-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-2,3,4,5-tetrahydro-1H-3-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2,3,4,5-tetrahydro-1H-3-benzazepine?
The IUPAC name of 7-bromo-2,3,4,5-tetrahydro-1H-3-benzazepine (CID 46840033) is 7-bromo-2,3,4,5-tetrahydro-1H-3-benzazepine.
What is the SMILES notation for 7-bromo-2,3,4,5-tetrahydro-1H-3-benzazepine?
The canonical SMILES for 7-bromo-2,3,4,5-tetrahydro-1H-3-benzazepine is Brc1ccc2c(c1)CCNCC2.
What is the InChIKey of 7-bromo-2,3,4,5-tetrahydro-1H-3-benzazepine?
The InChIKey is ZVNFJSFIRKPMES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN/c11-10-2-1-8-3-5-12-6-4-9(8)7-10/h1-2,7,12H,3-6H2.
What are the key properties of 7-bromo-2,3,4,5-tetrahydro-1H-3-benzazepine?
7-bromo-2,3,4,5-tetrahydro-1H-3-benzazepine has a molecular weight of 226.12 g/mol, XLogP of 2.14, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2,3,4,5-tetrahydro-1H-3-benzazepine is sourced from PubChem (CID 46840033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).