C26H17F8N5O2 — CID 46840217
5-[[2-(2,3-difluorophenyl)imidazo[4,5-d]pyridazin-5-yl]methyl]-3-[4-(4,4,4-trifluorobutoxy)-2-(trifluoromethyl)phenyl]-1,2-oxazole (PubChem CID 46840217) has the molecular formula C26H17F8N5O2 and a molecular weight of 583.44 g/mol. Its IUPAC name is 5-[[2-(2,3-difluorophenyl)imidazo[4,5-d]pyridazin-5-yl]methyl]-3-[4-(4,4,4-trifluorobutoxy)-2-(trifluoromethyl)phenyl]-1,2-oxazole.
| Compound Name | 5-[[2-(2,3-difluorophenyl)imidazo[4,5-d]pyridazin-5-yl]methyl]-3-[4-(4,4,4-trifluorobutoxy)-2-(trifluoromethyl)phenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 46840217 |
| Molecular Formula | C26H17F8N5O2 |
| Molecular Weight | 583.44 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | 5-[[2-(2,3-difluorophenyl)imidazo[4,5-d]pyridazin-5-yl]methyl]-3-[4-(4,4,4-trifluorobutoxy)-2-(trifluoromethyl)phenyl]-1,2-oxazole |
| SMILES | Fc1cccc(-c2nc3cnn(Cc4cc(-c5ccc(OCCCC(F)(F)F)cc5C(F)(F)F)no4)cc-3n2)c1F |
| InChI | InChI=1S/C26H17F8N5O2/c27-19-4-1-3-17(23(19)28)24-36-21-11-35-39(13-22(21)37-24)12-15-10-20(38-41-15)16-6-5-14(9-18(16)26(32,33)34)40-8-2-7-25(29,30)31/h1,3-6,9-11,13H,2,7-8,12H2 |
| InChIKey | RNQXFSXPNBSNHK-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.44 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|