C21H22F2N2O2 — CID 46840262
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-(4-fluoroanilino)-2-(4-fluorophenyl)acetate (PubChem CID 46840262) has the molecular formula C21H22F2N2O2 and a molecular weight of 372.42 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-(4-fluoroanilino)-2-(4-fluorophenyl)acetate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-(4-fluoroanilino)-2-(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 46840262 |
| Molecular Formula | C21H22F2N2O2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-(4-fluoroanilino)-2-(4-fluorophenyl)acetate |
| SMILES | O=C(O[C@H]1CN2CCC1CC2)C(Nc1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H22F2N2O2/c22-16-3-1-15(2-4-16)20(24-18-7-5-17(23)6-8-18)21(26)27-19-13-25-11-9-14(19)10-12-25/h1-8,14,19-20,24H,9-13H2/t19-,20?/m0/s1 |
| InChIKey | UFOAEEHQHVWDIF-XJDOXCRVSA-N |
| XLogP | 3.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |