C26H20F5N5O2 — CID 46840668
3-[4-butoxy-2-(trifluoromethyl)phenyl]-5-[[2-(2,3-difluorophenyl)imidazo[4,5-d]pyridazin-5-yl]methyl]-1,2-oxazole (PubChem CID 46840668) has the molecular formula C26H20F5N5O2 and a molecular weight of 529.47 g/mol. Its IUPAC name is 3-[4-butoxy-2-(trifluoromethyl)phenyl]-5-[[2-(2,3-difluorophenyl)imidazo[4,5-d]pyridazin-5-yl]methyl]-1,2-oxazole.
| Compound Name | 3-[4-butoxy-2-(trifluoromethyl)phenyl]-5-[[2-(2,3-difluorophenyl)imidazo[4,5-d]pyridazin-5-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 46840668 |
| Molecular Formula | C26H20F5N5O2 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | 3-[4-butoxy-2-(trifluoromethyl)phenyl]-5-[[2-(2,3-difluorophenyl)imidazo[4,5-d]pyridazin-5-yl]methyl]-1,2-oxazole |
| SMILES | CCCCOc1ccc(-c2cc(Cn3cc4nc(-c5cccc(F)c5F)nc-4cn3)on2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H20F5N5O2/c1-2-3-9-37-15-7-8-17(19(10-15)26(29,30)31)21-11-16(38-35-21)13-36-14-23-22(12-32-36)33-25(34-23)18-5-4-6-20(27)24(18)28/h4-8,10-12,14H,2-3,9,13H2,1H3 |
| InChIKey | GLESRIMBKSZBHI-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|