About N-(5-chloro-1,3-thiazol-2-yl)acetamide
N-(5-chloro-1,3-thiazol-2-yl)acetamide (PubChem CID 4684134) has the molecular formula C5H5ClN2OS
and a molecular weight of 176.63 g/mol. Its IUPAC name is N-(5-chloro-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(5-chloro-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 4684134 |
| Molecular Formula | C5H5ClN2OS |
| Molecular Weight | 176.63 g/mol |
| Exact Mass | 175.98 |
| IUPAC Name | N-(5-chloro-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(=O)Nc1ncc(Cl)s1 |
| InChI | InChI=1S/C5H5ClN2OS/c1-3(9)8-5-7-2-4(6)10-5/h2H,1H3,(H,7,8,9) |
| InChIKey | YLRXYIGXXMJPOP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.63 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-chloro-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloro-1,3-thiazol-2-yl)acetamide?
The IUPAC name of N-(5-chloro-1,3-thiazol-2-yl)acetamide (CID 4684134) is N-(5-chloro-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for N-(5-chloro-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for N-(5-chloro-1,3-thiazol-2-yl)acetamide is CC(=O)Nc1ncc(Cl)s1.
What is the InChIKey of N-(5-chloro-1,3-thiazol-2-yl)acetamide?
The InChIKey is YLRXYIGXXMJPOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClN2OS/c1-3(9)8-5-7-2-4(6)10-5/h2H,1H3,(H,7,8,9).
What are the key properties of N-(5-chloro-1,3-thiazol-2-yl)acetamide?
N-(5-chloro-1,3-thiazol-2-yl)acetamide has a molecular weight of 176.63 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloro-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 4684134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).