C16H21NO3 — CID 46841394
3,3,4-trideuterio-4-[3-(2,2,3,3,4,4,5,5-octadeuteriocyclopentyl)oxy-4-(trideuteriomethoxy)phenyl]pyrrolidin-2-one (PubChem CID 46841394) has the molecular formula C16H21NO3 and a molecular weight of 289.43 g/mol. Its IUPAC name is 3,3,4-trideuterio-4-[3-(2,2,3,3,4,4,5,5-octadeuteriocyclopentyl)oxy-4-(trideuteriomethoxy)phenyl]pyrrolidin-2-one.
| Compound Name | 3,3,4-trideuterio-4-[3-(2,2,3,3,4,4,5,5-octadeuteriocyclopentyl)oxy-4-(trideuteriomethoxy)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 46841394 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 3,3,4-trideuterio-4-[3-(2,2,3,3,4,4,5,5-octadeuteriocyclopentyl)oxy-4-(trideuteriomethoxy)phenyl]pyrrolidin-2-one |
| SMILES | [2H]C([2H])([2H])Oc1ccc(C2([2H])CNC(=O)C2([2H])[2H])cc1OC1C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C16H21NO3/c1-19-14-7-6-11(12-9-16(18)17-10-12)8-15(14)20-13-4-2-3-5-13/h6-8,12-13H,2-5,9-10H2,1H3,(H,17,18)/i1D3,2D2,3D2,4D2,5D2,9D2,12D |
| InChIKey | HJORMJIFDVBMOB-PLQRCKNSSA-N |
| XLogP | 2.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |