C7H10ClNO4 — CID 46841621
(2S,4S)-1-(2-chloroacetyl)-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 46841621) has the molecular formula C7H10ClNO4 and a molecular weight of 207.61 g/mol. Its IUPAC name is (2S,4S)-1-(2-chloroacetyl)-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-(2-chloroacetyl)-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 46841621 |
| Molecular Formula | C7H10ClNO4 |
| Molecular Weight | 207.61 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | (2S,4S)-1-(2-chloroacetyl)-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](O)CN1C(=O)CCl |
| InChI | InChI=1S/C7H10ClNO4/c8-2-6(11)9-3-4(10)1-5(9)7(12)13/h4-5,10H,1-3H2,(H,12,13)/t4-,5-/m0/s1 |
| InChIKey | VXLPYFZWBMGNSX-WHFBIAKZSA-N |
| XLogP | -0.73 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.61 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|